C13H18FNO5S — CID 63008006
3-fluoro-5-[3-methoxypropyl(methyl)sulfamoyl]-4-methylbenzoic acid (PubChem CID 63008006) has the molecular formula C13H18FNO5S and a molecular weight of 319.35 g/mol. Its IUPAC name is 3-fluoro-5-[3-methoxypropyl(methyl)sulfamoyl]-4-methylbenzoic acid.
| Compound Name | 3-fluoro-5-[3-methoxypropyl(methyl)sulfamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 63008006 |
| Molecular Formula | C13H18FNO5S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 3-fluoro-5-[3-methoxypropyl(methyl)sulfamoyl]-4-methylbenzoic acid |
| SMILES | COCCCN(C)S(=O)(=O)c1cc(C(=O)O)cc(F)c1C |
| InChI | InChI=1S/C13H18FNO5S/c1-9-11(14)7-10(13(16)17)8-12(9)21(18,19)15(2)5-4-6-20-3/h7-8H,4-6H2,1-3H3,(H,16,17) |
| InChIKey | WGHCVWATZAJXTM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|