C13H18FNO5S — CID 43578715
3-fluoro-5-[2-hydroxyethyl(propan-2-yl)sulfamoyl]-4-methylbenzoic acid (PubChem CID 43578715) has the molecular formula C13H18FNO5S and a molecular weight of 319.35 g/mol. Its IUPAC name is 3-fluoro-5-[2-hydroxyethyl(propan-2-yl)sulfamoyl]-4-methylbenzoic acid.
| Compound Name | 3-fluoro-5-[2-hydroxyethyl(propan-2-yl)sulfamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 43578715 |
| Molecular Formula | C13H18FNO5S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 3-fluoro-5-[2-hydroxyethyl(propan-2-yl)sulfamoyl]-4-methylbenzoic acid |
| SMILES | Cc1c(F)cc(C(=O)O)cc1S(=O)(=O)N(CCO)C(C)C |
| InChI | InChI=1S/C13H18FNO5S/c1-8(2)15(4-5-16)21(19,20)12-7-10(13(17)18)6-11(14)9(12)3/h6-8,16H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | UCYSHBBPLJKGSU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |