C12H17NO5S — CID 54876272
3-[2-hydroxyethyl(methyl)sulfamoyl]-4,5-dimethylbenzoic acid (PubChem CID 54876272) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is 3-[2-hydroxyethyl(methyl)sulfamoyl]-4,5-dimethylbenzoic acid.
| Compound Name | 3-[2-hydroxyethyl(methyl)sulfamoyl]-4,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 54876272 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 3-[2-hydroxyethyl(methyl)sulfamoyl]-4,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)N(C)CCO)c1C |
| InChI | InChI=1S/C12H17NO5S/c1-8-6-10(12(15)16)7-11(9(8)2)19(17,18)13(3)4-5-14/h6-7,14H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | CQVFHEOBHKMPTF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |