C14H20O5S — CID 62229233
3-(5-hydroxypentylsulfonyl)-4,5-dimethylbenzoic acid (PubChem CID 62229233) has the molecular formula C14H20O5S and a molecular weight of 300.38 g/mol. Its IUPAC name is 3-(5-hydroxypentylsulfonyl)-4,5-dimethylbenzoic acid.
| Compound Name | 3-(5-hydroxypentylsulfonyl)-4,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 62229233 |
| Molecular Formula | C14H20O5S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 3-(5-hydroxypentylsulfonyl)-4,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)CCCCCO)c1C |
| InChI | InChI=1S/C14H20O5S/c1-10-8-12(14(16)17)9-13(11(10)2)20(18,19)7-5-3-4-6-15/h8-9,15H,3-7H2,1-2H3,(H,16,17) |
| InChIKey | NDUFBVWAHSISAY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|