C13H15F3O4S — CID 115514460
3,4-dimethyl-5-(4,4,4-trifluorobutylsulfonyl)benzoic acid (PubChem CID 115514460) has the molecular formula C13H15F3O4S and a molecular weight of 324.32 g/mol. Its IUPAC name is 3,4-dimethyl-5-(4,4,4-trifluorobutylsulfonyl)benzoic acid.
| Compound Name | 3,4-dimethyl-5-(4,4,4-trifluorobutylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 115514460 |
| Molecular Formula | C13H15F3O4S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 3,4-dimethyl-5-(4,4,4-trifluorobutylsulfonyl)benzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)CCCC(F)(F)F)c1C |
| InChI | InChI=1S/C13H15F3O4S/c1-8-6-10(12(17)18)7-11(9(8)2)21(19,20)5-3-4-13(14,15)16/h6-7H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | XOKHXKNNBMKEBX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |