C11H9F5O4S — CID 105116126
3,4-difluoro-5-(4,4,4-trifluorobutylsulfonyl)benzoic acid (PubChem CID 105116126) has the molecular formula C11H9F5O4S and a molecular weight of 332.25 g/mol. Its IUPAC name is 3,4-difluoro-5-(4,4,4-trifluorobutylsulfonyl)benzoic acid.
| Compound Name | 3,4-difluoro-5-(4,4,4-trifluorobutylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 105116126 |
| Molecular Formula | C11H9F5O4S |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 3,4-difluoro-5-(4,4,4-trifluorobutylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1cc(F)c(F)c(S(=O)(=O)CCCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H9F5O4S/c12-7-4-6(10(17)18)5-8(9(7)13)21(19,20)3-1-2-11(14,15)16/h4-5H,1-3H2,(H,17,18) |
| InChIKey | XYJZPUVSBGGCLQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |