C11H11F4NO4S — CID 83047507
3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid (PubChem CID 83047507) has the molecular formula C11H11F4NO4S and a molecular weight of 329.27 g/mol. Its IUPAC name is 3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid.
| Compound Name | 3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 83047507 |
| Molecular Formula | C11H11F4NO4S |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)CCCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C11H11F4NO4S/c12-8-6-7(10(17)18)2-3-9(8)16-21(19,20)5-1-4-11(13,14)15/h2-3,6,16H,1,4-5H2,(H,17,18) |
| InChIKey | JETKMHPGWVQGMB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |