3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid

C11H11F4NO4S — CID 83047507

IUPAC3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid
SMILESO=C(O)c1ccc(NS(=O)(=O)CCCC(F)(F)F)c(F)c1
InChIInChI=1S/C11H11F4NO4S/c12-8-6-7(10(17)18)2-3-9(8)16-21(19,20)5-1-4-11(13,14)15/h2-3,6,16H,1,4-5H2,(H,17,18)
InChIKeyJETKMHPGWVQGMB-UHFFFAOYSA-N
MW329.27 g/mol
LogP2.61
Rot. Bonds6

About 3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid

3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid (PubChem CID 83047507) has the molecular formula C11H11F4NO4S and a molecular weight of 329.27 g/mol. Its IUPAC name is 3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid.

Molecular Properties

Compound Name3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid
PubChem CID83047507
Molecular FormulaC11H11F4NO4S
Molecular Weight329.27 g/mol
Exact Mass329.03
IUPAC Name3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid
SMILESO=C(O)c1ccc(NS(=O)(=O)CCCC(F)(F)F)c(F)c1
InChIInChI=1S/C11H11F4NO4S/c12-8-6-7(10(17)18)2-3-9(8)16-21(19,20)5-1-4-11(13,14)15/h2-3,6,16H,1,4-5H2,(H,17,18)
InChIKeyJETKMHPGWVQGMB-UHFFFAOYSA-N
XLogP2.61
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500329.27
LogP ≤ 52.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid?
The IUPAC name of 3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid (CID 83047507) is 3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid.
What is the SMILES notation for 3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid?
The canonical SMILES for 3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid is O=C(O)c1ccc(NS(=O)(=O)CCCC(F)(F)F)c(F)c1.
What is the InChIKey of 3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid?
The InChIKey is JETKMHPGWVQGMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F4NO4S/c12-8-6-7(10(17)18)2-3-9(8)16-21(19,20)5-1-4-11(13,14)15/h2-3,6,16H,1,4-5H2,(H,17,18).
What are the key properties of 3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid?
3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid has a molecular weight of 329.27 g/mol, XLogP of 2.61, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-(4,4,4-trifluorobutylsulfonylamino)benzoic acid is sourced from PubChem (CID 83047507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).