C17H12F7NO5S — CID 138697752
4-[[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]sulfamoylmethyl]benzoic acid (PubChem CID 138697752) has the molecular formula C17H12F7NO5S and a molecular weight of 475.34 g/mol. Its IUPAC name is 4-[[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]sulfamoylmethyl]benzoic acid.
| Compound Name | 4-[[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]sulfamoylmethyl]benzoic acid |
|---|---|
| PubChem CID | 138697752 |
| Molecular Formula | C17H12F7NO5S |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | 4-[[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]sulfamoylmethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CS(=O)(=O)Nc2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2F)cc1 |
| InChI | InChI=1S/C17H12F7NO5S/c18-12-7-11(15(28,16(19,20)21)17(22,23)24)5-6-13(12)25-31(29,30)8-9-1-3-10(4-2-9)14(26)27/h1-7,25,28H,8H2,(H,26,27) |
| InChIKey | NAEHTMMOAOVJEH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |