C8H7BrFNO4S — CID 28774124
2-[(4-bromo-2-fluorophenyl)sulfamoyl]acetic acid (PubChem CID 28774124) has the molecular formula C8H7BrFNO4S and a molecular weight of 312.12 g/mol. Its IUPAC name is 2-[(4-bromo-2-fluorophenyl)sulfamoyl]acetic acid.
| Compound Name | 2-[(4-bromo-2-fluorophenyl)sulfamoyl]acetic acid |
|---|---|
| PubChem CID | 28774124 |
| Molecular Formula | C8H7BrFNO4S |
| Molecular Weight | 312.12 g/mol |
| Exact Mass | 310.93 |
| IUPAC Name | 2-[(4-bromo-2-fluorophenyl)sulfamoyl]acetic acid |
| SMILES | O=C(O)CS(=O)(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C8H7BrFNO4S/c9-5-1-2-7(6(10)3-5)11-16(14,15)4-8(12)13/h1-3,11H,4H2,(H,12,13) |
| InChIKey | ASSXNAONCKMPRC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.12 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |