C22H20F7N3O4 — CID 91099351
[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]carbamic acid (PubChem CID 91099351) has the molecular formula C22H20F7N3O4 and a molecular weight of 523.41 g/mol. Its IUPAC name is [2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]carbamic acid.
| Compound Name | [2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 91099351 |
| Molecular Formula | C22H20F7N3O4 |
| Molecular Weight | 523.41 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | [2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(C(=O)N2CCN(Cc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)cc1F |
| InChI | InChI=1S/C22H20F7N3O4/c23-16-11-14(3-6-17(16)30-19(34)35)18(33)32-9-7-31(8-10-32)12-13-1-4-15(5-2-13)20(36,21(24,25)26)22(27,28)29/h1-6,11,30,36H,7-10,12H2,(H,34,35) |
| InChIKey | SXJBUQWNHDLPSC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |