C27H29F6N3O3 — CID 59175900
N-(cyclopropylmethyl)-2-[4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]acetamide (PubChem CID 59175900) has the molecular formula C27H29F6N3O3 and a molecular weight of 557.54 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-[4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]acetamide.
| Compound Name | N-(cyclopropylmethyl)-2-[4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]acetamide |
|---|---|
| PubChem CID | 59175900 |
| Molecular Formula | C27H29F6N3O3 |
| Molecular Weight | 557.54 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | N-(cyclopropylmethyl)-2-[4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]acetamide |
| SMILES | O=C(Cc1ccc(C(=O)N2CCN(Cc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)cc1)NCC1CC1 |
| InChI | InChI=1S/C27H29F6N3O3/c28-26(29,30)25(39,27(31,32)33)22-9-5-20(6-10-22)17-35-11-13-36(14-12-35)24(38)21-7-3-18(4-8-21)15-23(37)34-16-19-1-2-19/h3-10,19,39H,1-2,11-17H2,(H,34,37) |
| InChIKey | SQPCFSANEFCFIM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |