C28H30F6N4O5 — CID 59175829
methyl 1-[4-(cyclopropylmethylcarbamoylamino)benzoyl]-4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-2-carboxylate (PubChem CID 59175829) has the molecular formula C28H30F6N4O5 and a molecular weight of 616.56 g/mol. Its IUPAC name is methyl 1-[4-(cyclopropylmethylcarbamoylamino)benzoyl]-4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-2-carboxylate.
| Compound Name | methyl 1-[4-(cyclopropylmethylcarbamoylamino)benzoyl]-4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-2-carboxylate |
|---|---|
| PubChem CID | 59175829 |
| Molecular Formula | C28H30F6N4O5 |
| Molecular Weight | 616.56 g/mol |
| Exact Mass | 616.21 |
| IUPAC Name | methyl 1-[4-(cyclopropylmethylcarbamoylamino)benzoyl]-4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-2-carboxylate |
| SMILES | COC(=O)C1CN(Cc2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)CCN1C(=O)c1ccc(NC(=O)NCC2CC2)cc1 |
| InChI | InChI=1S/C28H30F6N4O5/c1-43-24(40)22-16-37(15-18-4-8-20(9-5-18)26(42,27(29,30)31)28(32,33)34)12-13-38(22)23(39)19-6-10-21(11-7-19)36-25(41)35-14-17-2-3-17/h4-11,17,22,42H,2-3,12-16H2,1H3,(H2,35,36,41) |
| InChIKey | HWNQAGNSJLKXSH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |