C19H26N2O3 — CID 44783614
methyl 4-benzyl-1-(cyclopentanecarbonyl)piperazine-2-carboxylate (PubChem CID 44783614) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is methyl 4-benzyl-1-(cyclopentanecarbonyl)piperazine-2-carboxylate.
| Compound Name | methyl 4-benzyl-1-(cyclopentanecarbonyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 44783614 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | methyl 4-benzyl-1-(cyclopentanecarbonyl)piperazine-2-carboxylate |
| SMILES | COC(=O)C1CN(Cc2ccccc2)CCN1C(=O)C1CCCC1 |
| InChI | InChI=1S/C19H26N2O3/c1-24-19(23)17-14-20(13-15-7-3-2-4-8-15)11-12-21(17)18(22)16-9-5-6-10-16/h2-4,7-8,16-17H,5-6,9-14H2,1H3 |
| InChIKey | BFWWVNRCFJYHJP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |