C18H23N3O4 — CID 44783659
methyl 1-(cyclopentanecarbonyl)-4-(pyridine-3-carbonyl)piperazine-2-carboxylate (PubChem CID 44783659) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is methyl 1-(cyclopentanecarbonyl)-4-(pyridine-3-carbonyl)piperazine-2-carboxylate.
| Compound Name | methyl 1-(cyclopentanecarbonyl)-4-(pyridine-3-carbonyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 44783659 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | methyl 1-(cyclopentanecarbonyl)-4-(pyridine-3-carbonyl)piperazine-2-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)c2cccnc2)CCN1C(=O)C1CCCC1 |
| InChI | InChI=1S/C18H23N3O4/c1-25-18(24)15-12-20(16(22)14-7-4-8-19-11-14)9-10-21(15)17(23)13-5-2-3-6-13/h4,7-8,11,13,15H,2-3,5-6,9-10,12H2,1H3 |
| InChIKey | TXFIFAMOQJZYOW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |