C22H28ClN3O — CID 23609169
1-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]methyl]-3-(4-ethylphenyl)urea (PubChem CID 23609169) has the molecular formula C22H28ClN3O and a molecular weight of 385.94 g/mol. Its IUPAC name is 1-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]methyl]-3-(4-ethylphenyl)urea.
| Compound Name | 1-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]methyl]-3-(4-ethylphenyl)urea |
|---|---|
| PubChem CID | 23609169 |
| Molecular Formula | C22H28ClN3O |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 1-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]methyl]-3-(4-ethylphenyl)urea |
| SMILES | CCc1ccc(NC(=O)NCC2CCN(Cc3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H28ClN3O/c1-2-17-5-9-21(10-6-17)25-22(27)24-15-18-11-13-26(14-12-18)16-19-3-7-20(23)8-4-19/h3-10,18H,2,11-16H2,1H3,(H2,24,25,27) |
| InChIKey | LMEPGMGQEMSAPY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |