C23H29N3O3 — CID 92717407
ethyl 4-[[(3S)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]methylcarbamoylamino]benzoate (PubChem CID 92717407) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is ethyl 4-[[(3S)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]methylcarbamoylamino]benzoate.
| Compound Name | ethyl 4-[[(3S)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]methylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 92717407 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | ethyl 4-[[(3S)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]methylcarbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)NC[C@@H]2CCN(Cc3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-3-29-22(27)20-8-10-21(11-9-20)25-23(28)24-14-19-12-13-26(16-19)15-18-6-4-17(2)5-7-18/h4-11,19H,3,12-16H2,1-2H3,(H2,24,25,28)/t19-/m0/s1 |
| InChIKey | XKSMUWRCPVVSHH-IBGZPJMESA-N |
| XLogP | 3.82 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |