C17H21FN6O — CID 95205026
1-[[(3S)-1-[(2-aminopyrimidin-5-yl)methyl]pyrrolidin-3-yl]methyl]-3-(4-fluorophenyl)urea (PubChem CID 95205026) has the molecular formula C17H21FN6O and a molecular weight of 344.39 g/mol. Its IUPAC name is 1-[[(3S)-1-[(2-aminopyrimidin-5-yl)methyl]pyrrolidin-3-yl]methyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[[(3S)-1-[(2-aminopyrimidin-5-yl)methyl]pyrrolidin-3-yl]methyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 95205026 |
| Molecular Formula | C17H21FN6O |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-[[(3S)-1-[(2-aminopyrimidin-5-yl)methyl]pyrrolidin-3-yl]methyl]-3-(4-fluorophenyl)urea |
| SMILES | Nc1ncc(CN2CC[C@@H](CNC(=O)Nc3ccc(F)cc3)C2)cn1 |
| InChI | InChI=1S/C17H21FN6O/c18-14-1-3-15(4-2-14)23-17(25)22-7-12-5-6-24(10-12)11-13-8-20-16(19)21-9-13/h1-4,8-9,12H,5-7,10-11H2,(H2,19,20,21)(H2,22,23,25)/t12-/m0/s1 |
| InChIKey | OYMYUAPURDUVCA-LBPRGKRZSA-N |
| XLogP | 1.84 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |