C24H27N5O — CID 45243187
N-[[1-[(2-aminopyrimidin-5-yl)methyl]piperidin-3-yl]methyl]-4-phenylbenzamide (PubChem CID 45243187) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is N-[[1-[(2-aminopyrimidin-5-yl)methyl]piperidin-3-yl]methyl]-4-phenylbenzamide.
| Compound Name | N-[[1-[(2-aminopyrimidin-5-yl)methyl]piperidin-3-yl]methyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 45243187 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | N-[[1-[(2-aminopyrimidin-5-yl)methyl]piperidin-3-yl]methyl]-4-phenylbenzamide |
| SMILES | Nc1ncc(CN2CCCC(CNC(=O)c3ccc(-c4ccccc4)cc3)C2)cn1 |
| InChI | InChI=1S/C24H27N5O/c25-24-27-14-19(15-28-24)17-29-12-4-5-18(16-29)13-26-23(30)22-10-8-21(9-11-22)20-6-2-1-3-7-20/h1-3,6-11,14-15,18H,4-5,12-13,16-17H2,(H,26,30)(H2,25,27,28) |
| InChIKey | FHKAUEXPPUPWKH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |