C22H26F2N4O2 — CID 43835566
1-(4-fluorophenyl)-3-[[3-[[(4-fluorophenyl)carbamoylamino]methyl]cyclohexyl]methyl]urea (PubChem CID 43835566) has the molecular formula C22H26F2N4O2 and a molecular weight of 416.47 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[[3-[[(4-fluorophenyl)carbamoylamino]methyl]cyclohexyl]methyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[[3-[[(4-fluorophenyl)carbamoylamino]methyl]cyclohexyl]methyl]urea |
|---|---|
| PubChem CID | 43835566 |
| Molecular Formula | C22H26F2N4O2 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[[3-[[(4-fluorophenyl)carbamoylamino]methyl]cyclohexyl]methyl]urea |
| SMILES | O=C(NCC1CCCC(CNC(=O)Nc2ccc(F)cc2)C1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H26F2N4O2/c23-17-4-8-19(9-5-17)27-21(29)25-13-15-2-1-3-16(12-15)14-26-22(30)28-20-10-6-18(24)7-11-20/h4-11,15-16H,1-3,12-14H2,(H2,25,27,29)(H2,26,28,30) |
| InChIKey | HRJQDDLRIBCMJZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |