C22H28N4O2S2 — CID 43834026
1-(4-sulfanylphenyl)-3-[[3-[[(4-sulfanylphenyl)carbamoylamino]methyl]cyclohexyl]methyl]urea (PubChem CID 43834026) has the molecular formula C22H28N4O2S2 and a molecular weight of 444.63 g/mol. Its IUPAC name is 1-(4-sulfanylphenyl)-3-[[3-[[(4-sulfanylphenyl)carbamoylamino]methyl]cyclohexyl]methyl]urea.
| Compound Name | 1-(4-sulfanylphenyl)-3-[[3-[[(4-sulfanylphenyl)carbamoylamino]methyl]cyclohexyl]methyl]urea |
|---|---|
| PubChem CID | 43834026 |
| Molecular Formula | C22H28N4O2S2 |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 1-(4-sulfanylphenyl)-3-[[3-[[(4-sulfanylphenyl)carbamoylamino]methyl]cyclohexyl]methyl]urea |
| SMILES | O=C(NCC1CCCC(CNC(=O)Nc2ccc(S)cc2)C1)Nc1ccc(S)cc1 |
| InChI | InChI=1S/C22H28N4O2S2/c27-21(25-17-4-8-19(29)9-5-17)23-13-15-2-1-3-16(12-15)14-24-22(28)26-18-6-10-20(30)11-7-18/h4-11,15-16,29-30H,1-3,12-14H2,(H2,23,25,27)(H2,24,26,28) |
| InChIKey | SGFHTTZZHYPKPT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|