C16H24N2O2 — CID 111472619
1-(3,4-dimethylphenyl)-3-[(3-hydroxycyclohexyl)methyl]urea (PubChem CID 111472619) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[(3-hydroxycyclohexyl)methyl]urea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[(3-hydroxycyclohexyl)methyl]urea |
|---|---|
| PubChem CID | 111472619 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[(3-hydroxycyclohexyl)methyl]urea |
| SMILES | Cc1ccc(NC(=O)NCC2CCCC(O)C2)cc1C |
| InChI | InChI=1S/C16H24N2O2/c1-11-6-7-14(8-12(11)2)18-16(20)17-10-13-4-3-5-15(19)9-13/h6-8,13,15,19H,3-5,9-10H2,1-2H3,(H2,17,18,20) |
| InChIKey | FJZGOPXBGIOKLZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |