C15H22N2O2 — CID 95983941
1-(3,4-dimethylphenyl)-3-[(1R,3S)-3-hydroxycyclohexyl]urea (PubChem CID 95983941) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[(1R,3S)-3-hydroxycyclohexyl]urea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[(1R,3S)-3-hydroxycyclohexyl]urea |
|---|---|
| PubChem CID | 95983941 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[(1R,3S)-3-hydroxycyclohexyl]urea |
| SMILES | Cc1ccc(NC(=O)N[C@@H]2CCC[C@H](O)C2)cc1C |
| InChI | InChI=1S/C15H22N2O2/c1-10-6-7-13(8-11(10)2)17-15(19)16-12-4-3-5-14(18)9-12/h6-8,12,14,18H,3-5,9H2,1-2H3,(H2,16,17,19)/t12-,14+/m1/s1 |
| InChIKey | QFFCPHCFXMUHGN-OCCSQVGLSA-N |
| XLogP | 2.73 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |