C14H18BrFN2O2 — CID 111476022
1-(3-bromo-5-fluorophenyl)-3-[(3-hydroxycyclohexyl)methyl]urea (PubChem CID 111476022) has the molecular formula C14H18BrFN2O2 and a molecular weight of 345.21 g/mol. Its IUPAC name is 1-(3-bromo-5-fluorophenyl)-3-[(3-hydroxycyclohexyl)methyl]urea.
| Compound Name | 1-(3-bromo-5-fluorophenyl)-3-[(3-hydroxycyclohexyl)methyl]urea |
|---|---|
| PubChem CID | 111476022 |
| Molecular Formula | C14H18BrFN2O2 |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 1-(3-bromo-5-fluorophenyl)-3-[(3-hydroxycyclohexyl)methyl]urea |
| SMILES | O=C(NCC1CCCC(O)C1)Nc1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C14H18BrFN2O2/c15-10-5-11(16)7-12(6-10)18-14(20)17-8-9-2-1-3-13(19)4-9/h5-7,9,13,19H,1-4,8H2,(H2,17,18,20) |
| InChIKey | FTHYLTXTLBYRMA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |