C16H27N5O — CID 56760339
1-[[1-[(2-ethylpyrimidin-5-yl)methyl]pyrrolidin-3-yl]methyl]-3-propan-2-ylurea (PubChem CID 56760339) has the molecular formula C16H27N5O and a molecular weight of 305.43 g/mol. Its IUPAC name is 1-[[1-[(2-ethylpyrimidin-5-yl)methyl]pyrrolidin-3-yl]methyl]-3-propan-2-ylurea.
| Compound Name | 1-[[1-[(2-ethylpyrimidin-5-yl)methyl]pyrrolidin-3-yl]methyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 56760339 |
| Molecular Formula | C16H27N5O |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 1-[[1-[(2-ethylpyrimidin-5-yl)methyl]pyrrolidin-3-yl]methyl]-3-propan-2-ylurea |
| SMILES | CCc1ncc(CN2CCC(CNC(=O)NC(C)C)C2)cn1 |
| InChI | InChI=1S/C16H27N5O/c1-4-15-17-8-14(9-18-15)11-21-6-5-13(10-21)7-19-16(22)20-12(2)3/h8-9,12-13H,4-7,10-11H2,1-3H3,(H2,19,20,22) |
| InChIKey | LTXACMCDLXSIFM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |