C20H23ClN2O2 — CID 58933474
N-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]methyl]-4-hydroxybenzamide (PubChem CID 58933474) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is N-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]methyl]-4-hydroxybenzamide.
| Compound Name | N-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]methyl]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 58933474 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]methyl]-4-hydroxybenzamide |
| SMILES | O=C(NCC1CCN(Cc2ccc(Cl)cc2)CC1)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H23ClN2O2/c21-18-5-1-16(2-6-18)14-23-11-9-15(10-12-23)13-22-20(25)17-3-7-19(24)8-4-17/h1-8,15,24H,9-14H2,(H,22,25) |
| InChIKey | OWPCRVVNAKWTCC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |