C16H24ClN3O2 — CID 69214587
(2S)-2-amino-N-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]methyl]-3-hydroxypropanamide (PubChem CID 69214587) has the molecular formula C16H24ClN3O2 and a molecular weight of 325.84 g/mol. Its IUPAC name is (2S)-2-amino-N-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]methyl]-3-hydroxypropanamide.
| Compound Name | (2S)-2-amino-N-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]methyl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 69214587 |
| Molecular Formula | C16H24ClN3O2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (2S)-2-amino-N-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]methyl]-3-hydroxypropanamide |
| SMILES | N[C@@H](CO)C(=O)NCC1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H24ClN3O2/c17-14-3-1-13(2-4-14)10-20-7-5-12(6-8-20)9-19-16(22)15(18)11-21/h1-4,12,15,21H,5-11,18H2,(H,19,22)/t15-/m0/s1 |
| InChIKey | SCJZFINUBWCLFW-HNNXBMFYSA-N |
| XLogP | 0.99 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |