C21H25Cl2N3O2 — CID 1259121
1-[[1-[(5-chloro-2-methoxyphenyl)methyl]piperidin-4-yl]methyl]-3-(3-chlorophenyl)urea (PubChem CID 1259121) has the molecular formula C21H25Cl2N3O2 and a molecular weight of 422.36 g/mol. Its IUPAC name is 1-[[1-[(5-chloro-2-methoxyphenyl)methyl]piperidin-4-yl]methyl]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[[1-[(5-chloro-2-methoxyphenyl)methyl]piperidin-4-yl]methyl]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 1259121 |
| Molecular Formula | C21H25Cl2N3O2 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 1-[[1-[(5-chloro-2-methoxyphenyl)methyl]piperidin-4-yl]methyl]-3-(3-chlorophenyl)urea |
| SMILES | COc1ccc(Cl)cc1CN1CCC(CNC(=O)Nc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H25Cl2N3O2/c1-28-20-6-5-18(23)11-16(20)14-26-9-7-15(8-10-26)13-24-21(27)25-19-4-2-3-17(22)12-19/h2-6,11-12,15H,7-10,13-14H2,1H3,(H2,24,25,27) |
| InChIKey | GMDNRMMSOLFPNJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |