C21H23ClF3N3O — CID 23609211
1-[[1-[(3-chlorophenyl)methyl]piperidin-4-yl]methyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 23609211) has the molecular formula C21H23ClF3N3O and a molecular weight of 425.88 g/mol. Its IUPAC name is 1-[[1-[(3-chlorophenyl)methyl]piperidin-4-yl]methyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[[1-[(3-chlorophenyl)methyl]piperidin-4-yl]methyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 23609211 |
| Molecular Formula | C21H23ClF3N3O |
| Molecular Weight | 425.88 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 1-[[1-[(3-chlorophenyl)methyl]piperidin-4-yl]methyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCC1CCN(Cc2cccc(Cl)c2)CC1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H23ClF3N3O/c22-18-5-1-3-16(11-18)14-28-9-7-15(8-10-28)13-26-20(29)27-19-6-2-4-17(12-19)21(23,24)25/h1-6,11-12,15H,7-10,13-14H2,(H2,26,27,29) |
| InChIKey | WSKFUGPZKOQRKM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.88 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |