C20H21F3N4O2 — CID 90521501
1-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 90521501) has the molecular formula C20H21F3N4O2 and a molecular weight of 406.41 g/mol. Its IUPAC name is 1-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 90521501 |
| Molecular Formula | C20H21F3N4O2 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 1-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCC1CCN(C(=O)c2cccnc2)CC1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H21F3N4O2/c21-20(22,23)16-4-1-5-17(11-16)26-19(29)25-12-14-6-9-27(10-7-14)18(28)15-3-2-8-24-13-15/h1-5,8,11,13-14H,6-7,9-10,12H2,(H2,25,26,29) |
| InChIKey | RPBGWKRSHIRYEA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |