C27H26F3N5O2 — CID 162598799
1-(aziridin-1-yl)-1-[1-(pyridine-3-carbonyl)piperidin-4-yl]-3-[4-[3-(trifluoromethyl)phenyl]phenyl]urea (PubChem CID 162598799) has the molecular formula C27H26F3N5O2 and a molecular weight of 509.53 g/mol. Its IUPAC name is 1-(aziridin-1-yl)-1-[1-(pyridine-3-carbonyl)piperidin-4-yl]-3-[4-[3-(trifluoromethyl)phenyl]phenyl]urea.
| Compound Name | 1-(aziridin-1-yl)-1-[1-(pyridine-3-carbonyl)piperidin-4-yl]-3-[4-[3-(trifluoromethyl)phenyl]phenyl]urea |
|---|---|
| PubChem CID | 162598799 |
| Molecular Formula | C27H26F3N5O2 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 1-(aziridin-1-yl)-1-[1-(pyridine-3-carbonyl)piperidin-4-yl]-3-[4-[3-(trifluoromethyl)phenyl]phenyl]urea |
| SMILES | O=C(c1cccnc1)N1CCC(N(C(=O)Nc2ccc(-c3cccc(C(F)(F)F)c3)cc2)N2CC2)CC1 |
| InChI | InChI=1S/C27H26F3N5O2/c28-27(29,30)22-5-1-3-20(17-22)19-6-8-23(9-7-19)32-26(37)35(34-15-16-34)24-10-13-33(14-11-24)25(36)21-4-2-12-31-18-21/h1-9,12,17-18,24H,10-11,13-16H2,(H,32,37) |
| InChIKey | XJWYLNHRENZGEH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 68.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|