C22H19F3N4O — CID 15950720
(4-pyrimidin-2-ylpiperazin-1-yl)-[4-[3-(trifluoromethyl)phenyl]phenyl]methanone (PubChem CID 15950720) has the molecular formula C22H19F3N4O and a molecular weight of 412.42 g/mol. Its IUPAC name is (4-pyrimidin-2-ylpiperazin-1-yl)-[4-[3-(trifluoromethyl)phenyl]phenyl]methanone.
| Compound Name | (4-pyrimidin-2-ylpiperazin-1-yl)-[4-[3-(trifluoromethyl)phenyl]phenyl]methanone |
|---|---|
| PubChem CID | 15950720 |
| Molecular Formula | C22H19F3N4O |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (4-pyrimidin-2-ylpiperazin-1-yl)-[4-[3-(trifluoromethyl)phenyl]phenyl]methanone |
| SMILES | O=C(c1ccc(-c2cccc(C(F)(F)F)c2)cc1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H19F3N4O/c23-22(24,25)19-4-1-3-18(15-19)16-5-7-17(8-6-16)20(30)28-11-13-29(14-12-28)21-26-9-2-10-27-21/h1-10,15H,11-14H2 |
| InChIKey | WNYOKIADMYAOIR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |