C22H15F7N4O — CID 46082092
(2,3,5,6-tetrafluorophenyl)-[4-[4-[3-(trifluoromethyl)phenyl]pyrimidin-2-yl]piperazin-1-yl]methanone (PubChem CID 46082092) has the molecular formula C22H15F7N4O and a molecular weight of 484.38 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl)-[4-[4-[3-(trifluoromethyl)phenyl]pyrimidin-2-yl]piperazin-1-yl]methanone.
| Compound Name | (2,3,5,6-tetrafluorophenyl)-[4-[4-[3-(trifluoromethyl)phenyl]pyrimidin-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46082092 |
| Molecular Formula | C22H15F7N4O |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl)-[4-[4-[3-(trifluoromethyl)phenyl]pyrimidin-2-yl]piperazin-1-yl]methanone |
| SMILES | O=C(c1c(F)c(F)cc(F)c1F)N1CCN(c2nccc(-c3cccc(C(F)(F)F)c3)n2)CC1 |
| InChI | InChI=1S/C22H15F7N4O/c23-14-11-15(24)19(26)17(18(14)25)20(34)32-6-8-33(9-7-32)21-30-5-4-16(31-21)12-2-1-3-13(10-12)22(27,28)29/h1-5,10-11H,6-9H2 |
| InChIKey | CAMXGUBDVCMXLE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|