C21H18ClF3N4O2S — CID 56696039
4-(4-chlorophenyl)-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrimidine (PubChem CID 56696039) has the molecular formula C21H18ClF3N4O2S and a molecular weight of 482.92 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrimidine.
| Compound Name | 4-(4-chlorophenyl)-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 56696039 |
| Molecular Formula | C21H18ClF3N4O2S |
| Molecular Weight | 482.92 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrimidine |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)N1CCN(c2nccc(-c3ccc(Cl)cc3)n2)CC1 |
| InChI | InChI=1S/C21H18ClF3N4O2S/c22-17-6-4-15(5-7-17)19-8-9-26-20(27-19)28-10-12-29(13-11-28)32(30,31)18-3-1-2-16(14-18)21(23,24)25/h1-9,14H,10-13H2 |
| InChIKey | AIALAIRYTXUWLR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.92 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |