C23H23F3N4O3S — CID 121107413
4-(4-ethoxyphenyl)-6-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrimidine (PubChem CID 121107413) has the molecular formula C23H23F3N4O3S and a molecular weight of 492.52 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-6-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrimidine.
| Compound Name | 4-(4-ethoxyphenyl)-6-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 121107413 |
| Molecular Formula | C23H23F3N4O3S |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 4-(4-ethoxyphenyl)-6-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrimidine |
| SMILES | CCOc1ccc(-c2cc(N3CCN(S(=O)(=O)c4cccc(C(F)(F)F)c4)CC3)ncn2)cc1 |
| InChI | InChI=1S/C23H23F3N4O3S/c1-2-33-19-8-6-17(7-9-19)21-15-22(28-16-27-21)29-10-12-30(13-11-29)34(31,32)20-5-3-4-18(14-20)23(24,25)26/h3-9,14-16H,2,10-13H2,1H3 |
| InChIKey | FXSYRIXJPSFDHJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |