C23H14F8N6O — CID 46092841
(2,3,4,5,6-pentafluorophenyl)-[4-[7-[3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]methanone (PubChem CID 46092841) has the molecular formula C23H14F8N6O and a molecular weight of 542.39 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)-[4-[7-[3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]methanone.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)-[4-[7-[3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46092841 |
| Molecular Formula | C23H14F8N6O |
| Molecular Weight | 542.39 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)-[4-[7-[3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]methanone |
| SMILES | O=C(c1c(F)c(F)c(F)c(F)c1F)N1CCN(c2nc3nccc(-c4cccc(C(F)(F)F)c4)n3n2)CC1 |
| InChI | InChI=1S/C23H14F8N6O/c24-15-14(16(25)18(27)19(28)17(15)26)20(38)35-6-8-36(9-7-35)22-33-21-32-5-4-13(37(21)34-22)11-2-1-3-12(10-11)23(29,30)31/h1-5,10H,6-9H2 |
| InChIKey | SUEBYAWFUYXWJL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 66.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|