C23H28N6O3 — CID 46091447
methyl 6-[4-[7-(3-methylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]-6-oxohexanoate (PubChem CID 46091447) has the molecular formula C23H28N6O3 and a molecular weight of 436.52 g/mol. Its IUPAC name is methyl 6-[4-[7-(3-methylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]-6-oxohexanoate.
| Compound Name | methyl 6-[4-[7-(3-methylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]-6-oxohexanoate |
|---|---|
| PubChem CID | 46091447 |
| Molecular Formula | C23H28N6O3 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | methyl 6-[4-[7-(3-methylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]-6-oxohexanoate |
| SMILES | COC(=O)CCCCC(=O)N1CCN(c2nc3nccc(-c4cccc(C)c4)n3n2)CC1 |
| InChI | InChI=1S/C23H28N6O3/c1-17-6-5-7-18(16-17)19-10-11-24-22-25-23(26-29(19)22)28-14-12-27(13-15-28)20(30)8-3-4-9-21(31)32-2/h5-7,10-11,16H,3-4,8-9,12-15H2,1-2H3 |
| InChIKey | BBQHKWQMVCBDRM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 92.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|