C22H26N6O3 — CID 46092716
methyl 2-[4-[7-(4-tert-butylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]-2-oxoacetate (PubChem CID 46092716) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is methyl 2-[4-[7-(4-tert-butylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]-2-oxoacetate.
| Compound Name | methyl 2-[4-[7-(4-tert-butylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 46092716 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | methyl 2-[4-[7-(4-tert-butylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)N1CCN(c2nc3nccc(-c4ccc(C(C)(C)C)cc4)n3n2)CC1 |
| InChI | InChI=1S/C22H26N6O3/c1-22(2,3)16-7-5-15(6-8-16)17-9-10-23-20-24-21(25-28(17)20)27-13-11-26(12-14-27)18(29)19(30)31-4/h5-10H,11-14H2,1-4H3 |
| InChIKey | GKKZSBJMWYKMAG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 92.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|