C16H23ClN6O — CID 92758144
(2S)-1-[4-(7-tert-butyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)piperazin-1-yl]-2-chloropropan-1-one (PubChem CID 92758144) has the molecular formula C16H23ClN6O and a molecular weight of 350.85 g/mol. Its IUPAC name is (2S)-1-[4-(7-tert-butyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)piperazin-1-yl]-2-chloropropan-1-one.
| Compound Name | (2S)-1-[4-(7-tert-butyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)piperazin-1-yl]-2-chloropropan-1-one |
|---|---|
| PubChem CID | 92758144 |
| Molecular Formula | C16H23ClN6O |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (2S)-1-[4-(7-tert-butyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)piperazin-1-yl]-2-chloropropan-1-one |
| SMILES | C[C@H](Cl)C(=O)N1CCN(c2nc3nccc(C(C)(C)C)n3n2)CC1 |
| InChI | InChI=1S/C16H23ClN6O/c1-11(17)13(24)21-7-9-22(10-8-21)15-19-14-18-6-5-12(16(2,3)4)23(14)20-15/h5-6,11H,7-10H2,1-4H3/t11-/m0/s1 |
| InChIKey | OEELRVMOWLAWLT-NSHDSACASA-N |
| XLogP | 1.70 |
| TPSA | 66.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|