C24H29ClN6O — CID 46091514
2-chloro-1-[4-[7-(4-cyclohexylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]propan-1-one (PubChem CID 46091514) has the molecular formula C24H29ClN6O and a molecular weight of 452.99 g/mol. Its IUPAC name is 2-chloro-1-[4-[7-(4-cyclohexylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]propan-1-one.
| Compound Name | 2-chloro-1-[4-[7-(4-cyclohexylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 46091514 |
| Molecular Formula | C24H29ClN6O |
| Molecular Weight | 452.99 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 2-chloro-1-[4-[7-(4-cyclohexylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]propan-1-one |
| SMILES | CC(Cl)C(=O)N1CCN(c2nc3nccc(-c4ccc(C5CCCCC5)cc4)n3n2)CC1 |
| InChI | InChI=1S/C24H29ClN6O/c1-17(25)22(32)29-13-15-30(16-14-29)24-27-23-26-12-11-21(31(23)28-24)20-9-7-19(8-10-20)18-5-3-2-4-6-18/h7-12,17-18H,2-6,13-16H2,1H3 |
| InChIKey | SGJOTAQBUMOUFP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.99 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|