C22H16F6N4O — CID 46082093
[4-[4-[3-(trifluoromethyl)phenyl]pyrimidin-2-yl]piperazin-1-yl]-(2,4,5-trifluorophenyl)methanone (PubChem CID 46082093) has the molecular formula C22H16F6N4O and a molecular weight of 466.39 g/mol. Its IUPAC name is [4-[4-[3-(trifluoromethyl)phenyl]pyrimidin-2-yl]piperazin-1-yl]-(2,4,5-trifluorophenyl)methanone.
| Compound Name | [4-[4-[3-(trifluoromethyl)phenyl]pyrimidin-2-yl]piperazin-1-yl]-(2,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 46082093 |
| Molecular Formula | C22H16F6N4O |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | [4-[4-[3-(trifluoromethyl)phenyl]pyrimidin-2-yl]piperazin-1-yl]-(2,4,5-trifluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)cc1F)N1CCN(c2nccc(-c3cccc(C(F)(F)F)c3)n2)CC1 |
| InChI | InChI=1S/C22H16F6N4O/c23-16-12-18(25)17(24)11-15(16)20(33)31-6-8-32(9-7-31)21-29-5-4-19(30-21)13-2-1-3-14(10-13)22(26,27)28/h1-5,10-12H,6-9H2 |
| InChIKey | SKPFDNNJJFINTO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|