C23H20F3N3O — CID 15950861
(4-pyridin-2-ylpiperazin-1-yl)-[4-[4-(trifluoromethyl)phenyl]phenyl]methanone (PubChem CID 15950861) has the molecular formula C23H20F3N3O and a molecular weight of 411.43 g/mol. Its IUPAC name is (4-pyridin-2-ylpiperazin-1-yl)-[4-[4-(trifluoromethyl)phenyl]phenyl]methanone.
| Compound Name | (4-pyridin-2-ylpiperazin-1-yl)-[4-[4-(trifluoromethyl)phenyl]phenyl]methanone |
|---|---|
| PubChem CID | 15950861 |
| Molecular Formula | C23H20F3N3O |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (4-pyridin-2-ylpiperazin-1-yl)-[4-[4-(trifluoromethyl)phenyl]phenyl]methanone |
| SMILES | O=C(c1ccc(-c2ccc(C(F)(F)F)cc2)cc1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C23H20F3N3O/c24-23(25,26)20-10-8-18(9-11-20)17-4-6-19(7-5-17)22(30)29-15-13-28(14-16-29)21-3-1-2-12-27-21/h1-12H,13-16H2 |
| InChIKey | XIUHRLDUSZSTLY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |