C21H18F3N5O — CID 68702242
(4-pyrimidin-2-ylpiperazin-1-yl)-[6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methanone (PubChem CID 68702242) has the molecular formula C21H18F3N5O and a molecular weight of 413.40 g/mol. Its IUPAC name is (4-pyrimidin-2-ylpiperazin-1-yl)-[6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methanone.
| Compound Name | (4-pyrimidin-2-ylpiperazin-1-yl)-[6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 68702242 |
| Molecular Formula | C21H18F3N5O |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (4-pyrimidin-2-ylpiperazin-1-yl)-[6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methanone |
| SMILES | O=C(c1ccc(-c2ccc(C(F)(F)F)cc2)nc1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H18F3N5O/c22-21(23,24)17-5-2-15(3-6-17)18-7-4-16(14-27-18)19(30)28-10-12-29(13-11-28)20-25-8-1-9-26-20/h1-9,14H,10-13H2 |
| InChIKey | AWZCMSMDXUTGAA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |