C16H14F3N3O2 — CID 97158981
pyridin-3-yl-[(3R)-3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]methanone (PubChem CID 97158981) has the molecular formula C16H14F3N3O2 and a molecular weight of 337.30 g/mol. Its IUPAC name is pyridin-3-yl-[(3R)-3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]methanone.
| Compound Name | pyridin-3-yl-[(3R)-3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 97158981 |
| Molecular Formula | C16H14F3N3O2 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | pyridin-3-yl-[(3R)-3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cccnc1)N1CC[C@@H](Oc2ccc(C(F)(F)F)cn2)C1 |
| InChI | InChI=1S/C16H14F3N3O2/c17-16(18,19)12-3-4-14(21-9-12)24-13-5-7-22(10-13)15(23)11-2-1-6-20-8-11/h1-4,6,8-9,13H,5,7,10H2/t13-/m1/s1 |
| InChIKey | SHTRMLSMZSFCKR-CYBMUJFWSA-N |
| XLogP | 2.79 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |