C21H25F3N2O3 — CID 162588142
2-adamantyl (3R)-3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidine-1-carboxylate (PubChem CID 162588142) has the molecular formula C21H25F3N2O3 and a molecular weight of 410.44 g/mol. Its IUPAC name is 2-adamantyl (3R)-3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidine-1-carboxylate.
| Compound Name | 2-adamantyl (3R)-3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 162588142 |
| Molecular Formula | C21H25F3N2O3 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-adamantyl (3R)-3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidine-1-carboxylate |
| SMILES | O=C(OC1C2CC3CC(C2)CC1C3)N1CC[C@@H](Oc2ccc(C(F)(F)F)cn2)C1 |
| InChI | InChI=1S/C21H25F3N2O3/c22-21(23,24)16-1-2-18(25-10-16)28-17-3-4-26(11-17)20(27)29-19-14-6-12-5-13(8-14)9-15(19)7-12/h1-2,10,12-15,17,19H,3-9,11H2/t12?,13?,14?,15?,17-,19?/m1/s1 |
| InChIKey | JQTLUTKJVVOXJS-ABRWGSHYSA-N |
| XLogP | 4.51 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |