C15H15FN4O2 — CID 122258424
[3-(5-fluoropyrimidin-2-yl)oxypiperidin-1-yl]-pyridin-3-ylmethanone (PubChem CID 122258424) has the molecular formula C15H15FN4O2 and a molecular weight of 302.31 g/mol. Its IUPAC name is [3-(5-fluoropyrimidin-2-yl)oxypiperidin-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [3-(5-fluoropyrimidin-2-yl)oxypiperidin-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 122258424 |
| Molecular Formula | C15H15FN4O2 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | [3-(5-fluoropyrimidin-2-yl)oxypiperidin-1-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CCCC(Oc2ncc(F)cn2)C1 |
| InChI | InChI=1S/C15H15FN4O2/c16-12-8-18-15(19-9-12)22-13-4-2-6-20(10-13)14(21)11-3-1-5-17-7-11/h1,3,5,7-9,13H,2,4,6,10H2 |
| InChIKey | JGABBHKJXXVREZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |