C21H19FN4O2 — CID 95140625
[(3R)-3-(4-fluorophenoxy)piperidin-1-yl]-(2-pyridin-3-ylpyrimidin-5-yl)methanone (PubChem CID 95140625) has the molecular formula C21H19FN4O2 and a molecular weight of 378.41 g/mol. Its IUPAC name is [(3R)-3-(4-fluorophenoxy)piperidin-1-yl]-(2-pyridin-3-ylpyrimidin-5-yl)methanone.
| Compound Name | [(3R)-3-(4-fluorophenoxy)piperidin-1-yl]-(2-pyridin-3-ylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 95140625 |
| Molecular Formula | C21H19FN4O2 |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | [(3R)-3-(4-fluorophenoxy)piperidin-1-yl]-(2-pyridin-3-ylpyrimidin-5-yl)methanone |
| SMILES | O=C(c1cnc(-c2cccnc2)nc1)N1CCC[C@@H](Oc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H19FN4O2/c22-17-5-7-18(8-6-17)28-19-4-2-10-26(14-19)21(27)16-12-24-20(25-13-16)15-3-1-9-23-11-15/h1,3,5-9,11-13,19H,2,4,10,14H2/t19-/m1/s1 |
| InChIKey | AEQOORRNRKZLHU-LJQANCHMSA-N |
| XLogP | 3.36 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |