C17H19N3O3 — CID 122255663
2-pyridin-3-yloxy-1-(3-pyridin-4-yloxypiperidin-1-yl)ethanone (PubChem CID 122255663) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-pyridin-3-yloxy-1-(3-pyridin-4-yloxypiperidin-1-yl)ethanone.
| Compound Name | 2-pyridin-3-yloxy-1-(3-pyridin-4-yloxypiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 122255663 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-pyridin-3-yloxy-1-(3-pyridin-4-yloxypiperidin-1-yl)ethanone |
| SMILES | O=C(COc1cccnc1)N1CCCC(Oc2ccncc2)C1 |
| InChI | InChI=1S/C17H19N3O3/c21-17(13-22-15-3-1-7-19-11-15)20-10-2-4-16(12-20)23-14-5-8-18-9-6-14/h1,3,5-9,11,16H,2,4,10,12-13H2 |
| InChIKey | SNYMYQVQCGJTGW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |