C18H19FN2O3 — CID 121017974
2-(2-fluorophenoxy)-1-(3-pyridin-4-yloxypiperidin-1-yl)ethanone (PubChem CID 121017974) has the molecular formula C18H19FN2O3 and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-1-(3-pyridin-4-yloxypiperidin-1-yl)ethanone.
| Compound Name | 2-(2-fluorophenoxy)-1-(3-pyridin-4-yloxypiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 121017974 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-(2-fluorophenoxy)-1-(3-pyridin-4-yloxypiperidin-1-yl)ethanone |
| SMILES | O=C(COc1ccccc1F)N1CCCC(Oc2ccncc2)C1 |
| InChI | InChI=1S/C18H19FN2O3/c19-16-5-1-2-6-17(16)23-13-18(22)21-11-3-4-15(12-21)24-14-7-9-20-10-8-14/h1-2,5-10,15H,3-4,11-13H2 |
| InChIKey | PJZAOPUGAAHYKM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |