C17H18FN3O4 — CID 90637391
2-(2-fluorophenoxy)-1-[3-(6-methoxypyrazin-2-yl)oxypyrrolidin-1-yl]ethanone (PubChem CID 90637391) has the molecular formula C17H18FN3O4 and a molecular weight of 347.35 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-1-[3-(6-methoxypyrazin-2-yl)oxypyrrolidin-1-yl]ethanone.
| Compound Name | 2-(2-fluorophenoxy)-1-[3-(6-methoxypyrazin-2-yl)oxypyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 90637391 |
| Molecular Formula | C17H18FN3O4 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-(2-fluorophenoxy)-1-[3-(6-methoxypyrazin-2-yl)oxypyrrolidin-1-yl]ethanone |
| SMILES | COc1cncc(OC2CCN(C(=O)COc3ccccc3F)C2)n1 |
| InChI | InChI=1S/C17H18FN3O4/c1-23-15-8-19-9-16(20-15)25-12-6-7-21(10-12)17(22)11-24-14-5-3-2-4-13(14)18/h2-5,8-9,12H,6-7,10-11H2,1H3 |
| InChIKey | ARIGGGCKEBAMAX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |