C19H28N2O2 — CID 122255705
3-cyclohexyl-1-(3-pyridin-4-yloxypiperidin-1-yl)propan-1-one (PubChem CID 122255705) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 3-cyclohexyl-1-(3-pyridin-4-yloxypiperidin-1-yl)propan-1-one.
| Compound Name | 3-cyclohexyl-1-(3-pyridin-4-yloxypiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 122255705 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 3-cyclohexyl-1-(3-pyridin-4-yloxypiperidin-1-yl)propan-1-one |
| SMILES | O=C(CCC1CCCCC1)N1CCCC(Oc2ccncc2)C1 |
| InChI | InChI=1S/C19H28N2O2/c22-19(9-8-16-5-2-1-3-6-16)21-14-4-7-18(15-21)23-17-10-12-20-13-11-17/h10-13,16,18H,1-9,14-15H2 |
| InChIKey | BVYKMTTZFIIBHA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |